logo
Home  > n-(2-hydroxy-6-methylphenyl)-2-((6-(4-(2-hydroxyethyl)piperazin-1-yl)-2-methylpyrimidin-4-yl)amino)thiazole-5-carboxamide

AA22360

1159977-25-9 | n-(2-hydroxy-6-methylphenyl)-2-((6-(4-(2-hydroxyethyl)piperazin-1-yl)-2-methylpyrimidin-4-yl)amino)thiazole-5-carboxamide

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA22360
Chemical Name: n-(2-hydroxy-6-methylphenyl)-2-((6-(4-(2-hydroxyethyl)piperazin-1-yl)-2-methylpyrimidin-4-yl)amino)thiazole-5-carboxamide
CAS Number: 1159977-25-9
Molecular Formula: C22H27N7O3S
Molecular Weight: 469.5599
MDL Number: MFCD24386643
SMILES: OCCN1CCN(CC1)c1cc(nc(n1)C)Nc1ncc(s1)C(=O)Nc1c(C)cccc1O

 

Upstream Synthesis Route 
  • The compound N-(2-Hydroxy-6-methylphenyl)-2-((6-(4-(2-hydroxyethyl)piperazin-1-yl)-2-methylpyrimidin-4-yl)amino)thiazole-5-carboxamide is a versatile building block in chemical synthesis. Its unique structure enables it to participate in various reactions to form complex molecules with specific functionalities. In organic synthesis, this compound can serve as a key intermediate for the preparation of bioactive compounds, pharmaceuticals, or materials with tailored properties. Its presence in a reaction can facilitate the introduction of multiple functional groups and stereocenters, making it a valuable tool for chemists seeking to design and construct novel molecules with potential applications in drug discovery, materials science, and other fields.
FEATURED PRODUCTS