AE54529
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE54529 |
Chemical Name: | rhodoxanthin |
CAS Number: | 116-30-3 |
SMILES: | CC(=CC=CC(=CC=C1C(=CC(=O)CC1(C)C)C)C)/C=C/C=C/C(=C/C=C/C(=C/C=C1/C(=CC(=O)CC1(C)C)C)/C)/C |
Rhodoxanthin, a natural pigment found in certain marine and freshwater algae, has gained significant attention in the field of chemical synthesis due to its unique properties and diverse applications. This brightly colored compound belongs to the class of carotenoids and possesses notable antioxidant properties, making it a valuable ingredient in various industries.In chemical synthesis, Rhodoxanthin serves as a versatile building block for creating a wide range of organic compounds. Its conjugated double-bond system allows for efficient manipulation of its structure, making it an ideal precursor for the synthesis of complex molecules. Researchers and chemists utilize Rhodoxanthin as a starting material in the development of new pharmaceuticals, agrochemicals, and materials with tailored properties.Moreover, the presence of functional groups in Rhodoxanthin enables chemists to introduce specific modifications through various chemical reactions, such as oxidation, reduction, and functional group transformations. This flexibility in its chemical reactivity makes Rhodoxanthin a valuable tool in designing novel molecules with enhanced biological activities or specialized functions.Overall, the application of Rhodoxanthin in chemical synthesis holds great promise for advancing research and innovation in diverse fields, from pharmaceuticals to materials science. Its unique structure and properties offer a myriad of opportunities for creating novel compounds with potential applications in various industries.