logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Pyrrolidines  > tert-Butyl 1,3-dioxo-2,7-diazaspiro[4.5]decane-7-carboxylate

AA14577

1160246-76-3 | tert-Butyl 1,3-dioxo-2,7-diazaspiro[4.5]decane-7-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $96.00 $67.00 -   +
250mg 95% in stock $221.00 $155.00 -   +
500mg 95% in stock $368.00 $258.00 -   +
1g 95% in stock $613.00 $429.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA14577
Chemical Name: tert-Butyl 1,3-dioxo-2,7-diazaspiro[4.5]decane-7-carboxylate
CAS Number: 1160246-76-3
Molecular Formula: C13H20N2O4
Molecular Weight: 268.3089
MDL Number: MFCD12195868
SMILES: O=C1NC(=O)C2(C1)CCCN(C2)C(=O)OC(C)(C)C

 

Computed Properties
Complexity: 427  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 19  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 2  
Undefined Atom Stereocenter Count: 1  
XLogP3: 0.2  

 

 

Upstream Synthesis Route
  • The tert-Butyl 1,3-dioxo-2,7-diazaspiro[4.5]decane-7-carboxylate is a versatile compound extensively utilized in chemical synthesis. This compound is particularly valuable in organic chemistry due to its unique structural features and reactivity. In chemical synthesis, tert-Butyl 1,3-dioxo-2,7-diazaspiro[4.5]decane-7-carboxylate serves as a crucial building block for the construction of complex molecules and heterocyclic compounds.Its spirocyclic structure makes it an ideal candidate for creating diverse molecular frameworks, offering opportunities for the development of novel pharmaceuticals, agrochemicals, and materials. By incorporating tert-Butyl 1,3-dioxo-2,7-diazaspiro[4.5]decane-7-carboxylate into synthetic pathways, chemists can access a wide array of functionalized derivatives with tailored properties.Furthermore, the presence of the ester and carbonyl functionalities in this compound enables selective functionalization and further elaboration, providing chemists with the flexibility to fine-tune the chemical properties of the resulting products. Overall, tert-Butyl 1,3-dioxo-2,7-diazaspiro[4.5]decane-7-carboxylate plays a crucial role in advancing the field of chemical synthesis by facilitating the construction of diverse and complex molecular structures with potential applications across various industries.
FEATURED PRODUCTS