logo
Home  > 8-(Benzyloxycarbonyl)-1-oxa-8-azaspiro-[4.6]undecane-3-carboxylic acid

AI10065

1160247-00-6 | 8-(Benzyloxycarbonyl)-1-oxa-8-azaspiro-[4.6]undecane-3-carboxylic acid

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AI10065
Chemical Name: 8-(Benzyloxycarbonyl)-1-oxa-8-azaspiro-[4.6]undecane-3-carboxylic acid
CAS Number: 1160247-00-6
Molecular Formula: C18H23NO5
Molecular Weight: 333.3789
MDL Number: MFCD12198538
SMILES: O=C(N1CCCC2(CC1)OCC(C2)C(=O)O)OCc1ccccc1

 

Upstream Synthesis Route 
  • The synthesis of 8-(Benzyloxycarbonyl)-1-Oxa-8-Azaspiro[4.6]Undecane-3-Carboxylic Acid plays a crucial role in organic chemistry as a versatile building block. With its unique structure and functional groups, this compound serves as a key intermediate in the construction of complex molecules and pharmaceutical agents. During chemical synthesis processes, this compound can undergo various transformations, such as amide bond formation, esterification, and selective deprotection of functional groups. Its spirocyclic structure confers distinct stereochemical properties, allowing for the creation of chiral centers in target molecules. Overall, this compound provides chemists with a valuable tool for the strategic design and synthesis of diverse organic compounds with specific properties and biological activities.
FEATURED PRODUCTS