AA14605
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | 2 weeks | $188.00 | $132.00 | - + | |
250mg | 95% | 2 weeks | $305.00 | $214.00 | - + | |
1g | 95% | 2 weeks | $594.00 | $416.00 | - + | |
5g | 95% | 2 weeks | $1,753.00 | $1,227.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA14605 |
Chemical Name: | tert-Butyl 3-(aminomethyl)-1-oxa-7-azaspiro[4.5]decane-7-carboxylate |
CAS Number: | 1160247-18-6 |
Molecular Formula: | C14H26N2O3 |
Molecular Weight: | 270.3678 |
MDL Number: | MFCD12198562 |
SMILES: | NCC1COC2(C1)CCCN(C2)C(=O)OC(C)(C)C |
The tert-Butyl 3-(aminomethyl)-1-oxa-7-azaspiro[4.5]decane-7-carboxylate is a versatile compound that finds widespread application in chemical synthesis. This unique compound serves as a key building block in the creation of various pharmaceuticals, particularly those targeting neurodegenerative diseases and central nervous system disorders. Its spirocyclic structure imparts molecular rigidity, enhancing its potential for drug design and development. Additionally, the presence of the tert-butyl and ester functional groups provides opportunities for further chemical modifications to fine-tune the compound's properties for specific applications. This compound's role as a structural motif in medicinal chemistry highlights its significance in the synthesis of bioactive molecules with diverse pharmacological profiles.