AI10108
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | in stock | $350.00 | $245.00 | - + | |
100mg | 95% | in stock | $975.00 | $682.00 | - + | |
250mg | 95% | in stock | $1,606.00 | $1,124.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI10108 |
Chemical Name: | tert-Butyl 2'-oxo-2',4'-dihydro-1'h-spiro[pyrrolidine-3,3'-quinoline]-1-carboxylate |
CAS Number: | 1160247-71-1 |
Molecular Formula: | C17H22N2O3 |
Molecular Weight: | 302.36818000000005 |
MDL Number: | MFCD12198632 |
SMILES: | O=C(N1CCC2(C1)Cc1ccccc1NC2=O)OC(C)(C)C |
Complexity: | 471 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 1.9 |
Tert-Butyl 2-Oxo-2,4-Dihydro-1H-Spiro[Pyrrolidine-3,3-Quinoline]-1-Carboxylate is a versatile compound widely utilized in chemical synthesis due to its unique structure and reactivity. In synthetic chemistry, this compound serves as a valuable building block for the construction of complex molecules with diverse functionalities. Its spirocyclic structure imparts rigidity and stereochemical control to synthetic pathways, making it a valuable intermediate in the preparation of biologically active compounds and natural product derivatives. Its ester functionality allows for facile manipulation through various chemical transformations, enabling the introduction of different substituents and functional groups to tailor the properties of the final product. Additionally, the presence of the carbonyl group offers opportunities for further derivatization, expanding the synthetic utility of this compound in the creation of novel molecular architectures.