logo
Home  > Benzyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5h)-carboxylate

AA14595

1160248-14-5 | Benzyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5h)-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $120.00 $84.00 -   +
250mg 95% in stock $160.00 $112.00 -   +
500mg 95% in stock $267.00 $187.00 -   +
1g 95% in stock $400.00 $280.00 -   +
5g 95% in stock $1,196.00 $838.00 -   +
10g 95% in stock $1,993.00 $1,395.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA14595
Chemical Name: Benzyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5h)-carboxylate
CAS Number: 1160248-14-5
Molecular Formula: C15H13Cl2N3O2
Molecular Weight: 338.1886
MDL Number: MFCD12198784
SMILES: Clc1nc(Cl)c2c(n1)CCN(C2)C(=O)OCc1ccccc1

 

Upstream Synthesis Route 
  • Benzyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate is a versatile compound that plays a crucial role in chemical synthesis. Its presence in a synthesis reaction can lead to the formation of structurally complex molecules with unique properties. This compound serves as a valuable building block in the creation of pharmaceuticals, agrochemicals, and materials with tailored functions. Its strategic incorporation in the synthesis of various organic compounds enables chemists to access a diverse range of molecular structures, thereby expanding the possibilities for the development of new products with specific applications in different industries.
FEATURED PRODUCTS