AA14615
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $44.00 | $31.00 | - + | |
1g | 98% | in stock | $78.00 | $54.00 | - + | |
5g | 98% | in stock | $253.00 | $177.00 | - + | |
10g | 98% | in stock | $505.00 | $353.00 | - + | |
25g | 98% | in stock | $1,193.00 | $835.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA14615 |
Chemical Name: | tert-Butyl 3-formylpyridin-4-ylcarbamate |
CAS Number: | 116026-93-8 |
Molecular Formula: | C11H14N2O3 |
Molecular Weight: | 222.2405 |
MDL Number: | MFCD01860246 |
SMILES: | O=Cc1cnccc1NC(=O)OC(C)(C)C |
Complexity: | 260 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.4 |
The tert-Butyl (3-formylpyridin-4-yl)carbamate is a versatile compound widely utilized in chemical synthesis for the preparation of various functionalized molecules. It serves as a valuable building block in organic chemistry, particularly in the synthesis of heterocyclic compounds and pharmaceutical intermediates. With its unique structure, this compound enables efficient formation of complex molecular architectures through diverse synthetic pathways. Its application extends to the development of novel compounds with potential biological activities, making it a key component in medicinal chemistry research. In addition, the tert-Butyl (3-formylpyridin-4-yl)carbamate offers exciting opportunities in the design and synthesis of advanced materials with tailored properties for diverse industrial applications.