116026-94-9 | 2-N-Boc-amino-3-formylpyridine

Packsize	Purity	Availability	Price	Discounted Price
100mg	95%	in stock	$177.00	$124.00
250mg	95%	in stock	$339.00	$237.00
1g	95%	in stock	$1,007.00	$705.00
5g	95%	in stock	$3,867.00	$2,707.00

Description

• Catalog Number: AA14614
• Chemical Name: 2-N-Boc-amino-3-formylpyridine
• CAS Number: 116026-94-9
• Molecular Formula: C11H14N2O3
• Molecular Weight: 222.2405
• MDL Number: MFCD03086225
• SMILES: O=Cc1cccnc1NC(=O)OC(C)(C)C

Upstream Synthesis Route

2-N-Boc-amino-3-formylpyridine is a valuable chemical compound commonly used in chemical synthesis processes. This compound serves as a versatile building block in organic synthesis due to its unique properties and reactivity. Specifically, 2-N-Boc-amino-3-formylpyridine is often utilized for the introduction of the Boc (tert-butoxycarbonyl) protecting group on amino functionalities in various molecules. This protective group helps to prevent unwanted reactions or interactions during subsequent synthetic steps, allowing for precise and controlled manipulation of the molecule's structure. Additionally, the formyl group on the pyridine ring provides a site for further functionalization through various coupling reactions, enabling the synthesis of structurally diverse compounds with tailored properties. In summary, the application of 2-N-Boc-amino-3-formylpyridine in chemical synthesis plays a crucial role in the efficient construction of complex molecules with specific functionalities for various research and industrial purposes.