AA14720
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $39.00 | $27.00 | - + | |
1g | 95% | in stock | $72.00 | $50.00 | - + | |
5g | 95% | in stock | $281.00 | $197.00 | - + | |
10g | 95% | in stock | $479.00 | $335.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA14720 |
Chemical Name: | Methyl 3-bromo-4,5-dichlorobenzoate |
CAS Number: | 1160574-77-5 |
Molecular Formula: | C8H5BrCl2O2 |
Molecular Weight: | 283.9341 |
MDL Number: | MFCD11846093 |
SMILES: | COC(=O)c1cc(Cl)c(c(c1)Br)Cl |
Complexity: | 201 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.7 |
Methyl 3-bromo-4,5-dichlorobenzoate is a valuable compound in chemical synthesis due to its versatility and reactivity. This compound serves as a key building block in the development of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure allows for diverse functional group transformations, enabling the synthesis of complex molecular structures.In organic synthesis, Methyl 3-bromo-4,5-dichlorobenzoate can undergo various reactions such as nucleophilic substitution, palladium-catalyzed cross-coupling, and reduction reactions. These reactions facilitate the introduction of different functional groups, enabling the synthesis of structurally diverse compounds. Additionally, the presence of bromine and chlorine atoms in the molecule imparts unique reactivity, making it a valuable precursor in organometallic chemistry.Furthermore, Methyl 3-bromo-4,5-dichlorobenzoate can be used as a starting material for the synthesis of biologically active molecules, heterocyclic compounds, and chiral building blocks. Its ability to undergo selective reactions and form new carbon-carbon and carbon-heteroatom bonds makes it a versatile tool in organic synthesis.Overall, Methyl 3-bromo-4,5-dichlorobenzoate plays a crucial role in the development of novel compounds with potential applications in the pharmaceutical and agrochemical industries. Its synthetic utility and reactivity make it a valuable intermediate for chemists working on the synthesis of complex organic molecules.