AV18831
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $43.00 | $31.00 | - + | |
250mg | 95% | in stock | $97.00 | $68.00 | - + | |
1g | 95% | in stock | $206.00 | $144.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV18831 |
Chemical Name: | (E)-tert-Butyl 4-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)vinyl)piperidine-1-carboxylate |
CAS Number: | 1160924-51-5 |
Molecular Formula: | C18H32BNO4 |
Molecular Weight: | 337.262 |
MDL Number: | MFCD28388343 |
SMILES: | O=C(N1CCC(CC1)/C=C/B1OC(C(O1)(C)C)(C)C)OC(C)(C)C |
Complexity: | 472 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
The (E)-(2-(1-(tert-Butoxycarbonyl)piperidin-4-yl)vinyl)boronic acid pinacol ester is a versatile compound commonly utilized in chemical synthesis for the formation of carbon-carbon bonds. This compound serves as a valuable building block in organic synthesis, particularly in the field of medicinal chemistry and drug development.One of the key applications of (E)-(2-(1-(tert-Butoxycarbonyl)piperidin-4-yl)vinyl)boronic acid pinacol ester is its effectiveness in Suzuki-Miyaura cross-coupling reactions. By coupling this boronic acid pinacol ester with various aryl halides or pseudohalides in the presence of a palladium catalyst, chemists can efficiently construct complex organic molecules with high regio- and stereo-selectivity.Furthermore, the (E)-(2-(1-(tert-Butoxycarbonyl)piperidin-4-yl)vinyl)boronic acid pinacol ester can also be employed in other types of carbon-carbon bond-forming reactions such as Heck and Sonogashira couplings. Its structural features make it a valuable tool for the synthesis of bioactive compounds, natural products, and pharmaceutical intermediates.In summary, the (E)-(2-(1-(tert-Butoxycarbonyl)piperidin-4-yl)vinyl)boronic acid pinacol ester plays a crucial role in modern organic synthesis by enabling efficient and selective formation of carbon-carbon bonds, making it an indispensable component in the toolbox of synthetic chemists.