AB46732
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $13.00 | $9.00 | - + | |
25g | 95% | in stock | $20.00 | $14.00 | - + | |
100g | 95% | in stock | $65.00 | $45.00 | - + | |
500g | 95% | in stock | $140.00 | $98.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46732 |
Chemical Name: | (2S)-2-{[(benzyloxy)carbonyl]amino}-3-phenylpropanoic acid |
CAS Number: | 1161-13-3 |
Molecular Formula: | C17H17NO4 |
Molecular Weight: | 299.32118 |
MDL Number: | MFCD00020418 |
SMILES: | O=C(N[C@H](C(=O)O)Cc1ccccc1)OCc1ccccc1 |
Complexity: | 360 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 2.1 |
N-Cbz-L-Phenylalanine, also known as N-Carbobenzyloxy-L-Phenylalanine, is a valuable amino acid derivative that plays a crucial role in chemical synthesis. This compound is commonly used as a versatile building block in the preparation of peptides, which are essential molecules in biological and pharmaceutical research.In chemical synthesis, N-Cbz-L-Phenylalanine serves as a key intermediate for the introduction of the Cbz (carbobenzyloxy) protecting group. This protecting group helps to shield the amino group of phenylalanine, allowing for selective reactions at other functional groups in the molecule. This controlled reactivity is essential for the stepwise assembly of peptides and complex organic molecules.By utilizing N-Cbz-L-Phenylalanine in peptide synthesis, chemists can precisely manipulate the sequence of amino acids to create customized peptides with specific biological activities. Additionally, the Cbz protecting group can be selectively removed under mild conditions, providing access to the free amino group for further modifications or structural elucidation.Overall, the strategic application of N-Cbz-L-Phenylalanine in chemical synthesis enables the efficient and precise construction of peptide-based molecules with diverse applications in drug discovery, biochemical research, and materials science.
Biochimica et biophysica acta 20120201
European journal of medicinal chemistry 20090401
BMC biochemistry 20090101
Analytica chimica acta 20070515
Biotechnology and bioengineering 20030330
Journal of biomedical materials research 20020401
Chemical communications (Cambridge, England) 20011007