AA14941
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $6.00 | $4.00 | - + | |
10mg | 98% | in stock | $8.00 | $6.00 | - + | |
25mg | 98% | in stock | $12.00 | $9.00 | - + | |
50mg | 98% | in stock | $20.00 | $14.00 | - + | |
100mg | 98% | in stock | $34.00 | $24.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA14941 |
Chemical Name: | N-(4-Chloro-3-methoxyphenyl)pyridine-2-carboxamide |
CAS Number: | 1161205-04-4 |
Molecular Formula: | C13H11ClN2O2 |
Molecular Weight: | 262.6916 |
MDL Number: | MFCD16618402 |
SMILES: | COc1cc(ccc1Cl)NC(=O)c1ccccn1 |
Complexity: | 288 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.6 |
Molecular pharmacology 20120901
Journal of medicinal chemistry 20111110
Journal of medicinal chemistry 20110728
Journal of medicinal chemistry 20110224
Journal of medicinal chemistry 20090723