AA15325
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $28.00 | $19.00 | - + | |
250mg | 98% | in stock | $35.00 | $24.00 | - + | |
1g | 98% | in stock | $43.00 | $30.00 | - + | |
5g | 98% | in stock | $118.00 | $82.00 | - + | |
10g | 98% | in stock | $201.00 | $141.00 | - + | |
25g | 98% | in stock | $386.00 | $270.00 | - + | |
100g | 98% | in stock | $1,317.00 | $922.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA15325 |
Chemical Name: | 4-Bromo-1-[(4-methylbenzene)sulfonyl]pyrazole |
CAS Number: | 116228-41-2 |
Molecular Formula: | C10H9BrN2O2S |
Molecular Weight: | 301.1597 |
MDL Number: | MFCD06080375 |
SMILES: | Cc1ccc(cc1)S(=O)(=O)n1ncc(c1)Br |
Complexity: | 333 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.5 |
4-Bromo-1-tosyl-1H-pyrazole is a versatile compound that finds wide application in chemical synthesis. It serves as a key building block in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. With its unique chemical structure, 4-Bromo-1-tosyl-1H-pyrazole plays a crucial role in the formation of complex molecules through diverse synthetic routes. This compound is particularly valued for its ability to participate in important reactions such as cross-coupling, nucleophilic substitution, and cycloaddition reactions, enabling the efficient synthesis of novel chemical entities with potential biological activities. Additionally, the presence of the bromo and tosyl functional groups in 4-Bromo-1-tosyl-1H-pyrazole imparts enhanced reactivity and selectivity, making it a valuable reagent in modern organic synthesis strategies. Its versatility and applicability make 4-Bromo-1-tosyl-1H-pyrazole a valuable tool for chemists engaged in the design and synthesis of complex molecules for various scientific and industrial purposes.