AA15512
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $265.00 | $186.00 | - + | |
1g | 97% | in stock | $634.00 | $444.00 | - + | |
5g | 97% | in stock | $1,878.00 | $1,315.00 | - + | |
10g | 97% | in stock | $2,810.00 | $1,967.00 | - + | |
25g | 97% | in stock | $5,608.00 | $3,925.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA15512 |
Chemical Name: | (5-Acetyl-2-methoxyphenyl)acetic acid |
CAS Number: | 116296-30-1 |
Molecular Formula: | C11H12O4 |
Molecular Weight: | 208.2106 |
MDL Number: | MFCD06373492 |
SMILES: | COc1ccc(cc1CC(=O)O)C(=O)C |
Complexity: | 249 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1 |
The 2-(5-Acetyl-2-methoxyphenyl)acetic acid is a valuable compound widely used in chemical synthesis as a versatile building block. It serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure allows for diverse functional group transformations, making it a valuable tool for organic chemists in designing and synthesizing complex molecules. Due to its reactivity and compatibility with a variety of reaction conditions, this compound is particularly useful in the synthesis of bioactive compounds and drug discovery research.