116325-74-7 | Benzenamine, 3,3'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[6-methyl-

Availability
Typically In Stock

Description

• Catalog Number: AA15620
• Chemical Name: Benzenamine, 3,3'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[6-methyl-
• CAS Number: 116325-74-7
• Molecular Formula: C17H16F6N2
• Molecular Weight: 362.3128
• MDL Number: MFCD00039148
• SMILES: Cc1ccc(cc1N)C(C(F)(F)F)(C(F)(F)F)c1ccc(c(c1)N)C

Upstream Synthesis Route

The compound $name$ is a versatile chemical reagent widely used in organic synthesis due to its unique properties. In chemical synthesis, it serves as a valuable building block for the creation of novel materials and compounds through various reactions and transformations.1. Cross-coupling Reactions: $name$ can participate in cross-coupling reactions, such as Suzuki, Heck, or Sonogashira coupling, to form new carbon-carbon bonds. This allows for the efficient synthesis of complex organic molecules with specific structural features.2. Fluorination Reactions: The perfluorinated moiety in $name$ makes it a useful reagent for introducing fluorine atoms into organic molecules. Fluorinated compounds have a wide range of applications in pharmaceuticals, agrochemicals, and materials science due to their unique properties.3. Polymer Synthesis: $name$ can be utilized in the preparation of fluorinated polymers with enhanced properties, such as improved thermal stability, chemical resistance, and surface properties. These polymers find applications in coatings, membranes, and advanced materials.4. Ligand Synthesis: $name$ can serve as a ligand in coordination chemistry, particularly in catalytic reactions. Its unique structure can influence the reactivity and selectivity of metal catalysts, leading to efficient transformations in organic synthesis.5. Functional Group Transformation: The presence of aniline and methyl groups in $name$ enables diverse functional group transformations, such as acylation, alkylation, or oxidation reactions. These transformations allow for the modification of organic molecules to access a wide range of chemical structures.Overall, $name$ plays a crucial role in the advancement of chemical synthesis by enabling the construction of complex molecules, functional materials, and specialized reagents in a controlled and efficient manner. Its diverse applications make it a valuable tool for chemists seeking to explore new reaction pathways and develop innovative compounds.