AA15649
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $29.00 | $21.00 | - + | |
5g | 95% | in stock | $73.00 | $51.00 | - + | |
25g | 95% | in stock | $203.00 | $142.00 | - + | |
100g | 95% | in stock | $667.00 | $467.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA15649 |
Chemical Name: | N-Methoxy-n-methyl-4-(trifluoromethyl)benzamide |
CAS Number: | 116332-61-7 |
Molecular Formula: | C10H10F3NO2 |
Molecular Weight: | 233.1871 |
MDL Number: | MFCD08689795 |
SMILES: | CON(C(=O)c1ccc(cc1)C(F)(F)F)C |
Complexity: | 247 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.3 |
N-Methoxy-N-methyl-4-(trifluoromethyl)benzamide, often referred to as $name$, is a versatile compound widely used in chemical synthesis. With its unique structure and properties, $name$ plays a crucial role in various organic reactions and transformations.$name$ is commonly employed as a reagent in the synthesis of complex organic molecules due to its ability to facilitate key chemical reactions. One of the primary applications of $name$ is its utility as a reagent in amide bond formation, a fundamental process in organic chemistry. By reacting $name$ with appropriate substrates, chemists can efficiently form amide bonds, enabling the synthesis of various peptides, pharmaceuticals, and natural products.Additionally, $name$ is utilized in the preparation of heterocyclic compounds and nitrogen-containing molecules. Its trifluoromethyl group imparts unique electronic and steric effects, making it a valuable building block in the synthesis of bioactive compounds and agrochemicals. Furthermore, the methoxy and methyl groups in $name$ provide additional synthetic versatility, allowing for the introduction of various functional groups in target molecules.In summary, the application of N-Methoxy-N-methyl-4-(trifluoromethyl)benzamide in chemical synthesis offers chemists a powerful tool for the construction of complex organic molecules with diverse structures and properties.