AA15674
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $36.00 | $26.00 | - + | |
1g | 95% | in stock | $100.00 | $70.00 | - + | |
5g | 95% | in stock | $468.00 | $327.00 | - + | |
10g | 95% | in stock | $892.00 | $624.00 | - + | |
25g | 95% | in stock | $1,879.00 | $1,316.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA15674 |
Chemical Name: | 4-Bromo-2-methylbenzenesulfonamide |
CAS Number: | 116340-67-1 |
Molecular Formula: | C7H8BrNO2S |
Molecular Weight: | 250.1129 |
MDL Number: | MFCD08234785 |
SMILES: | Brc1ccc(c(c1)C)S(=O)(=O)N |
Complexity: | 247 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.5 |
4-Bromo-2-methylbenzenesulfonamide, also known as BMSA, is a versatile compound widely used in chemical synthesis as a key building block. This compound serves as a valuable intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals due to its unique structure and reactivity. In organic synthesis, 4-Bromo-2-methylbenzenesulfonamide can undergo a range of reactions, including nucleophilic substitution, aromatic substitution, and transition metal-catalyzed coupling reactions. Its sulfonamide functional group provides opportunities for further derivatization, making it a valuable tool for creating structurally diverse compounds. Additionally, the presence of the bromine atom allows for further functionalization through cross-coupling reactions, enabling the introduction of additional substituents or complex functionalities. Overall, 4-Bromo-2-methylbenzenesulfonamide plays a crucial role in the synthesis of various compounds with pharmaceutical, agrochemical, and material science applications.