AA15883
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $11.00 | $8.00 | - + | |
5g | 98% | in stock | $13.00 | $9.00 | - + | |
10g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $25.00 | $18.00 | - + | |
100g | 98% | in stock | $77.00 | $54.00 | - + | |
500g | 98% | in stock | $332.00 | $233.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA15883 |
Chemical Name: | Z-Tyr-OH |
CAS Number: | 1164-16-5 |
Molecular Formula: | C17H17NO5 |
Molecular Weight: | 315.3206 |
MDL Number: | MFCD00191899 |
SMILES: | O=C(N[C@H](C(=O)O)Cc1ccc(cc1)O)OCc1ccccc1 |
Complexity: | 386 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 1.7 |
N-Benzyloxycarbonyl-L-tyrosine is a versatile compound widely used in chemical synthesis for its ability to serve as a protected amino acid. Its application in peptide synthesis is particularly notable, where it acts as a key building block for constructing complex peptide chains. By incorporating N-Benzyloxycarbonyl-L-tyrosine into peptide sequences, chemists can selectively protect the tyrosine residue, allowing for sequential and controlled peptide bond formation. This compound plays a crucial role in the controlled synthesis of peptides with specific sequences and functionalities, making it an indispensable tool in the field of chemical synthesis.
Bioorganic & medicinal chemistry letters 20101101
Journal of controlled release : official journal of the Controlled Release Society 20081021
Biomedical chromatography : BMC 20061001
Bioconjugate chemistry 20050101
Journal of the American Chemical Society 20021218