AE10745
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $25.00 | $17.00 | - + | |
25g | 98% | in stock | $57.00 | $40.00 | - + | |
100g | 98% | in stock | $177.00 | $124.00 | - + | |
500g | 98% | in stock | $611.00 | $428.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10745 |
Chemical Name: | trans-3-(2,3,4-Trimethoxyphenyl)-2-propenoic acid |
CAS Number: | 116406-19-0 |
Molecular Formula: | C12H14O5 |
Molecular Weight: | 238.2366 |
MDL Number: | MFCD00014376 |
SMILES: | COc1c(/C=C/C(=O)O)ccc(c1OC)OC |
Complexity: | 276 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.7 |
Zhongguo Zhong yao za zhi = Zhongguo zhongyao zazhi = China journal of Chinese materia medica 20061001