AA15860
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $97.00 | $68.00 | - + | |
5g | 98% | in stock | $289.00 | $203.00 | - + | |
10g | 98% | in stock | $510.00 | $357.00 | - + | |
25g | 98% | in stock | $1,092.00 | $765.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA15860 |
Chemical Name: | (1R,2R)-1,2-Diaminocyclohexane D-tartrate |
CAS Number: | 116407-32-0 |
Molecular Formula: | C10H20N2O6 |
Molecular Weight: | 264.2756 |
MDL Number: | MFCD18311881 |
SMILES: | O[C@@H]([C@@H](C(=O)O)O)C(=O)O.N[C@@H]1CCCC[C@H]1N |
Complexity: | 197 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 6 |
Rotatable Bond Count: | 3 |
The chiral compound (1R,2R)-Cyclohexane-1,2-diamine (2S,3S)-2,3-dihydroxysuccinate plays a crucial role in chemical synthesis as a versatile building block for creating complex organic molecules. This compound's unique stereochemistry allows for selective control over the orientation and arrangement of functional groups in the target molecule. In particular, (1R,2R)-Cyclohexane-1,2-diamine (2S,3S)-2,3-dihydroxysuccinate is commonly employed in asymmetric synthesis strategies, enabling the production of enantiomerically pure compounds with high efficiency and yield. Its application extends to the synthesis of pharmaceuticals, agrochemicals, and fine chemicals where precise stereochemical control is essential for desired biological or chemical activities.