logo
Home  > Chemistry  > Organic Building Blocks  > Nitroes  > 2,5-Difluoro-4-nitrobenzoic acid

AA16105

116465-48-6 | 2,5-Difluoro-4-nitrobenzoic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $6.00 $5.00 -   +
5g 95% in stock $17.00 $12.00 -   +
10g 95% in stock $29.00 $21.00 -   +
25g 95% in stock $72.00 $51.00 -   +
100g 95% in stock $277.00 $194.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA16105
Chemical Name: 2,5-Difluoro-4-nitrobenzoic acid
CAS Number: 116465-48-6
Molecular Formula: C7H3F2NO4
Molecular Weight: 203.0998
MDL Number: MFCD03425705
SMILES: [O-][N+](=O)c1cc(F)c(cc1F)C(=O)O
NSC Number: 59332

 

Computed Properties
Complexity: 255  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 14  
Hydrogen Bond Acceptor Count: 6  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 1  
XLogP3: 1.5  

 

 

Upstream Synthesis Route
  • 2,5-Difluoro-4-nitrobenzoic acid is a valuable chemical compound widely utilized in chemical synthesis for its unique properties and versatile applications. As a key building block in organic synthesis, this compound serves as an essential intermediate in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Its judicious incorporation into synthetic pathways enables chemists to introduce specific functional groups with precision, facilitating the synthesis of complex molecular structures. Additionally, 2,5-Difluoro-4-nitrobenzoic acid exhibits exceptional reactivity towards a variety of coupling reactions, making it a valuable tool for the construction of diverse molecular scaffolds. Its utility extends to the development of novel materials with tailored properties, showcasing its significance in the realm of modern organic synthesis.
FEATURED PRODUCTS