AA16105
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $6.00 | $5.00 | - + | |
5g | 95% | in stock | $17.00 | $12.00 | - + | |
10g | 95% | in stock | $29.00 | $21.00 | - + | |
25g | 95% | in stock | $72.00 | $51.00 | - + | |
100g | 95% | in stock | $277.00 | $194.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA16105 |
Chemical Name: | 2,5-Difluoro-4-nitrobenzoic acid |
CAS Number: | 116465-48-6 |
Molecular Formula: | C7H3F2NO4 |
Molecular Weight: | 203.0998 |
MDL Number: | MFCD03425705 |
SMILES: | [O-][N+](=O)c1cc(F)c(cc1F)C(=O)O |
NSC Number: | 59332 |
Complexity: | 255 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.5 |
2,5-Difluoro-4-nitrobenzoic acid is a valuable chemical compound widely utilized in chemical synthesis for its unique properties and versatile applications. As a key building block in organic synthesis, this compound serves as an essential intermediate in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Its judicious incorporation into synthetic pathways enables chemists to introduce specific functional groups with precision, facilitating the synthesis of complex molecular structures. Additionally, 2,5-Difluoro-4-nitrobenzoic acid exhibits exceptional reactivity towards a variety of coupling reactions, making it a valuable tool for the construction of diverse molecular scaffolds. Its utility extends to the development of novel materials with tailored properties, showcasing its significance in the realm of modern organic synthesis.