AA16257
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 97% | in stock | $18.00 | $13.00 | - + | |
5g | 97% | in stock | $86.00 | $60.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA16257 |
Chemical Name: | 5-Nitro-2-indanone |
CAS Number: | 116530-60-0 |
Molecular Formula: | C9H7NO3 |
Molecular Weight: | 177.1568 |
MDL Number: | MFCD00598938 |
SMILES: | O=C1Cc2c(C1)cc(cc2)[N+](=O)[O-] |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 1.1 |
5-Nitro-2-Indanone is a versatile compound that finds wide application in chemical synthesis. This compound serves as a key building block in the development of various pharmaceuticals, agrochemicals, and other fine chemicals due to its unique chemical properties. Its nitro group allows for a range of chemical transformations, making it a valuable intermediate in organic synthesis. In particular, 5-Nitro-2-Indanone is often used in the preparation of complex molecules through various synthetic routes, including reduction, oxidation, and substitution reactions. By incorporating this compound into synthetic pathways, chemists can efficiently access a diverse array of molecular structures with potential applications in drug discovery, materials science, and other fields.