AE13262
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE13262 |
Chemical Name: | FMOC-ACPC-OH |
CAS Number: | 116857-11-5 |
Molecular Formula: | C19H17NO4 |
Molecular Weight: | 323.3426 |
MDL Number: | MFCD00190873 |
SMILES: | C1CC1(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
The (9H-Fluoren-9-yl)methyl (S)-(2-oxotetrahydrofuran-3-yl-4,4-d2)carbamate is a versatile compound widely used in chemical synthesis due to its unique properties. In chemical reactions, this compound serves as a key intermediate for the introduction of deuterium atoms into molecules, allowing for isotopic labeling studies. Its specific structure enables precise control over the incorporation of deuterium, making it an essential tool for researchers studying reaction mechanisms, metabolic pathways, and drug metabolism. By utilizing (9H-Fluoren-9-yl)methyl (S)-(2-oxotetrahydrofuran-3-yl-4,4-d2)carbamate in synthesis, chemists can access a valuable tool for tracking molecular transformations and gaining insights into complex chemical processes.