AA17091
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $11.00 | $8.00 | - + | |
1g | 95% | in stock | $18.00 | $13.00 | - + | |
5g | 95% | in stock | $81.00 | $57.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA17091 |
Chemical Name: | 6-Chloro-7-nitro-2H-benzo[b][1,4]oxazin-3(4H)-one |
CAS Number: | 116862-22-7 |
Molecular Formula: | C8H5ClN2O4 |
Molecular Weight: | 228.5893 |
MDL Number: | MFCD02660643 |
SMILES: | O=C1COc2c(N1)cc(c(c2)[N+](=O)[O-])Cl |
6-Chloro-7-nitro-2H-1,4-benzoxazin-3(4H)-one is a versatile compound frequently utilized in chemical synthesis as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and organic compounds. Due to its unique structure and reactivity, this compound serves as a valuable building block for the synthesis of heterocyclic compounds, which are crucial in drug discovery and development. Its nitro and chloro substituents make it an ideal candidate for further functionalization to introduce a wide range of different chemical groups, enabling the creation of diverse chemical structures with desired properties. In particular, 6-Chloro-7-nitro-2H-1,4-benzoxazin-3(4H)-one plays a significant role in the pharmaceutical industry, where it is commonly employed in the synthesis of novel drug candidates with potential therapeutic benefits. Its application in chemical synthesis showcases its importance as a versatile and valuable compound in the field of organic chemistry.