logo
Home  > 9,10-Anthracenedione, 1,8-dihydroxy-

AA17292

117-10-2 | 9,10-Anthracenedione, 1,8-dihydroxy-

Packsize Purity Availability Price Discounted Price    Quantity
25mg 95% in stock $8.00 $5.00 -   +
5g 95% in stock $12.00 $8.00 -   +
10g 95% in stock $20.00 $14.00 -   +
25g 95% in stock $33.00 $23.00 -   +
100g 95% in stock $126.00 $89.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA17292
Chemical Name: 9,10-Anthracenedione, 1,8-dihydroxy-
CAS Number: 117-10-2
Molecular Formula: C14H8O4
Molecular Weight: 240.2109
MDL Number: MFCD00001211
SMILES: Oc1cccc2c1C(=O)c1c(C2=O)cccc1O

 

Computed Properties
Complexity: 346  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 18  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 2  
XLogP3: 3.2  

 

 

Upstream Synthesis Route
  • 1,8-Dihydroxyanthraquinone, also known as quinizarin, is a versatile chemical compound widely utilized in chemical synthesis applications. This compound plays a crucial role in organic chemistry as a building block for the synthesis of various complex organic molecules. Its unique structure containing two hydroxyl groups and a quinone moiety enables it to participate in a range of chemical reactions, making it an invaluable tool for synthetic chemists.In chemical synthesis, 1,8-Dihydroxyanthraquinone is commonly employed as a key intermediate in the production of dyes, pigments, and pharmaceuticals. It serves as a precursor for the synthesis of anthraquinone-based dyes, which are widely used in textiles, printing, and coloring applications. Additionally, its reactivity allows for the formation of fused-ring compounds, which are essential in developing new materials with diverse properties.Moreover, 1,8-Dihydroxyanthraquinone is utilized in the synthesis of biologically active molecules, including natural products and pharmaceutical intermediates. Its ability to undergo diverse transformations, such as oxidation, reduction, and substitution reactions, makes it a valuable component in the creation of complex organic structures with potential therapeutic properties.Overall, the application of 1,8-Dihydroxyanthraquinone in chemical synthesis demonstrates its significance as a versatile building block for creating a wide range of functional materials and bioactive compounds.
Literature
FEATURED PRODUCTS