AA17312
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $57.00 | $40.00 | - + | |
5g | 95% | in stock | $161.00 | $113.00 | - + | |
10g | 95% | in stock | $265.00 | $186.00 | - + | |
25g | 95% | in stock | $446.00 | $312.00 | - + | |
100g | 95% | in stock | $1,317.00 | $922.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA17312 |
Chemical Name: | 2-Amino-1,5-naphthalenedisulfonic acid |
CAS Number: | 117-62-4 |
Molecular Formula: | C10H9NO6S2 |
Molecular Weight: | 303.3116 |
MDL Number: | MFCD00021512 |
SMILES: | Nc1ccc2c(c1S(=O)(=O)O)cccc2S(=O)(=O)O |
NSC Number: | 60279 |
Complexity: | 531 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.5 |
2-Amino-1,5-naphthalenedisulfonic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound plays a crucial role in a variety of reactions due to its unique structure and properties. One of the key applications of 2-Amino-1,5-naphthalenedisulfonic acid is its use as a building block in the synthesis of dyes and pigments. The sulfonic acid groups in the molecule allow for easy functionalization, enabling the attachment of different chromophores to create vibrant and stable colorants. Additionally, 2-Amino-1,5-naphthalenedisulfonic acid is utilized in the production of pharmaceuticals and agrochemicals, where its aromatic structure and acid-base properties contribute to the formation of biologically active compounds. Overall, this compound serves as a valuable tool in the field of chemical synthesis, facilitating the creation of diverse molecules with important industrial applications.