AA17460
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $6.00 | $4.00 | - + | |
5g | 97% | in stock | $7.00 | $5.00 | - + | |
10g | 97% | in stock | $10.00 | $7.00 | - + | |
25g | 97% | in stock | $23.00 | $17.00 | - + | |
100g | 97% | in stock | $85.00 | $60.00 | - + | |
500g | 97% | in stock | $382.00 | $268.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA17460 |
Chemical Name: | Boc-L-phenylglycinol |
CAS Number: | 117049-14-6 |
Molecular Formula: | C13H19NO3 |
Molecular Weight: | 237.2949 |
MDL Number: | MFCD00274206 |
SMILES: | OC[C@H](c1ccccc1)NC(=O)OC(C)(C)C |
Complexity: | 242 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.8 |
Journal of thrombosis and haemostasis : JTH 20040301
Bioorganic & medicinal chemistry letters 19980602