AA17460
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $15.00 | $10.00 | - + | |
5g | 97% | in stock | $16.00 | $11.00 | - + | |
10g | 97% | in stock | $22.00 | $15.00 | - + | |
25g | 97% | in stock | $28.00 | $19.00 | - + | |
100g | 97% | in stock | $88.00 | $61.00 | - + | |
500g | 97% | in stock | $432.00 | $302.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA17460 |
Chemical Name: | Boc-L-phenylglycinol |
CAS Number: | 117049-14-6 |
Molecular Formula: | C13H19NO3 |
Molecular Weight: | 237.2949 |
MDL Number: | MFCD00274206 |
SMILES: | OC[C@H](c1ccccc1)NC(=O)OC(C)(C)C |
Complexity: | 242 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.8 |
The (S)-tert-Butyl (2-hydroxy-1-phenylethyl)carbamate is a versatile compound widely used in chemical synthesis as a chiral building block. Its unique structure allows for precise control over the stereochemistry of synthesized molecules, making it valuable in the production of pharmaceuticals, agrochemicals, and other fine chemicals. By incorporating this compound into synthesis routes, chemists can introduce chirality in a controlled manner, leading to the creation of enantiopure products with enhanced biological activity and selectivity. Additionally, the (S)-tert-Butyl (2-hydroxy-1-phenylethyl)carbamate serves as a key intermediate in the preparation of complex organic molecules, enabling efficient and sustainable synthesis strategies in the field of medicinal chemistry and drug discovery.
Journal of thrombosis and haemostasis : JTH 20040301
Bioorganic & medicinal chemistry letters 19980602