AE14535
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $88.00 | $62.00 | - + | |
1g | 98% | in stock | $226.00 | $158.00 | - + | |
5g | 98% | in stock | $812.00 | $568.00 | - + | |
25g | 98% | in stock | $2,864.00 | $2,005.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE14535 |
Chemical Name: | N'-(1-Methylazepan-4-yl)benzohydrazine |
CAS Number: | 117078-69-0 |
Molecular Formula: | C14H22ClN3O |
Molecular Weight: | 283.79698 |
MDL Number: | MFCD09753821 |
SMILES: | CN1CCCC(CC1)NNC(=O)c1ccccc1.Cl |
Benzoic acid, 2-(hexahydro-1-methyl-1H-azepin-4-yl)hydrazide, hydrochloride (1:1) is a versatile compound commonly used in chemical synthesis processes. This compound serves as an important building block in the creation of various pharmaceuticals, agrochemicals, and organic compounds. It is particularly valued for its ability to undergo a range of chemical reactions, including condensation, cyclization, and substitution, making it a valuable tool in the development of complex molecules.In chemical synthesis, Benzoic acid, 2-(hexahydro-1-methyl-1H-azepin-4-yl)hydrazide, hydrochloride (1:1) can be employed as a key intermediate in the preparation of novel drug candidates, such as anti-cancer agents or antimicrobial compounds. Its unique structural features and reactive functional groups allow for the manipulation of its chemical properties, enabling the introduction of specific functionalities or stereochemistry required for target molecules.Furthermore, this compound can participate in transformations that facilitate the formation of heterocyclic compounds, which are prevalent in pharmaceuticals and biologically active molecules. Its use in chemical synthesis not only enables the efficient production of valuable compounds but also offers opportunities for exploring new reaction pathways and innovative synthetic strategies in organic chemistry.