AA17666
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $36.00 | $25.00 | - + | |
5g | 98% | in stock | $115.00 | $81.00 | - + | |
25g | 98% | in stock | $415.00 | $291.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA17666 |
Chemical Name: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-5-carboxylic acid, 3',6'-dihydroxy-3-oxo-, compd. with 3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-6-carboxylate (1:1) |
CAS Number: | 1171493-85-8 |
Molecular Formula: | C42H24O14 |
Molecular Weight: | 752.6316 |
MDL Number: | MFCD00151081 |
SMILES: | Oc1ccc2c(c1)Oc1c(C32OC(=O)c2c3ccc(c2)C(=O)O)ccc(c1)O.Oc1ccc2c(c1)Oc1c(C32OC(=O)c2c3cc(cc2)C(=O)O)ccc(c1)O |
The compound 3',6'-Dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-5-carboxylic acid when combined in a 1:1 ratio with 3',6'-dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-6-carboxylic acid serves as a potent reagent in chemical synthesis. This unique combination offers a versatile platform for the development of novel pharmaceutical intermediates and fine chemicals. By harnessing the reactive properties of both components, this compound duo enables the formation of complex molecular structures with high efficiency and precision. In the realm of organic synthesis, this compound plays a crucial role in the creation of diverse molecular architectures with applications ranging from drug discovery to materials science.