AA17787
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $46.00 | $32.00 | - + | |
250mg | 97% | in stock | $73.00 | $51.00 | - + | |
1g | 97% | in stock | $186.00 | $130.00 | - + | |
5g | 97% | in stock | $647.00 | $453.00 | - + | |
10g | 97% | in stock | $1,163.00 | $814.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA17787 |
Chemical Name: | 5-(Trifluoromethyl)benzene-1,3-dicarboxylic acid |
CAS Number: | 117186-03-5 |
Molecular Formula: | C9H5F3O4 |
Molecular Weight: | 234.12880959999998 |
MDL Number: | MFCD22205769 |
SMILES: | OC(=O)c1cc(cc(c1)C(F)(F)F)C(=O)O |
Complexity: | 278 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.9 |
5-(Trifluoromethyl)benzene-1,3-dicarboxylic acid is a versatile compound that is widely used in chemical synthesis. Due to its unique structure containing a trifluoromethyl group, this acid is often employed as a building block in the synthesis of various pharmaceuticals, agrochemicals, and materials.One key application of 5-(Trifluoromethyl)benzene-1,3-dicarboxylic acid is in the development of novel drug molecules. By incorporating this acid into the molecular structure of pharmaceutical compounds, chemists can enhance the potency, bioavailability, and metabolic stability of the resulting drugs. The trifluoromethyl group can also influence the compound's interactions with biological targets, leading to improved therapeutic effects.In addition, 5-(Trifluoromethyl)benzene-1,3-dicarboxylic acid is utilized in the synthesis of specialty chemicals and materials. Its presence in the molecular framework of these compounds can impart unique physical and chemical properties, making them valuable for various industrial applications. The acid's ability to participate in diverse chemical reactions further expands its utility in the creation of functionalized products with tailored properties.Overall, the use of 5-(Trifluoromethyl)benzene-1,3-dicarboxylic acid in chemical synthesis offers a powerful tool for designing and producing novel compounds with enhanced properties and functionalities. Its versatile nature and ability to modulate the properties of target molecules make it a valuable building block in the realm of synthetic chemistry.