logo
Home  > Ethyl 4-(trifluoromethyl)-2-pyridinecarboxylate

AA17803

1171919-08-6 | Ethyl 4-(trifluoromethyl)-2-pyridinecarboxylate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $90.00 $63.00 -   +
1g 97% in stock $155.00 $108.00 -   +
5g 97% in stock $403.00 $282.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA17803
Chemical Name: Ethyl 4-(trifluoromethyl)-2-pyridinecarboxylate
CAS Number: 1171919-08-6
Molecular Formula: C9H8F3NO2
Molecular Weight: 219.1605
MDL Number: MFCD12498713
SMILES: CCOC(=O)c1nccc(c1)C(F)(F)F

 

Upstream Synthesis Route 
  • The Ethyl 4-(trifluoromethyl)picolinate is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it a valuable building block in the creation of various organic molecules. Specifically, this compound plays a crucial role in the synthesis of pharmaceuticals, agrochemicals, and materials with fluorinated motifs. By incorporating Ethyl 4-(trifluoromethyl)picolinate into reaction pathways, chemists can introduce the trifluoromethyl group into target molecules, enhancing their biological activity or altering their physicochemical properties. Additionally, this compound serves as a key intermediate in the preparation of diverse fluorinated compounds, contributing to the development of novel molecules with enhanced properties and potential applications in various industries.
FEATURED PRODUCTS