AX03390
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $111.00 | $78.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX03390 |
Chemical Name: | SoyasaponinAa |
CAS Number: | 117230-33-8 |
Molecular Formula: | C64H100O31 |
Molecular Weight: | 1365.4602 |
MDL Number: | MFCD11617933 |
SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)[C@H]([C@H]2O[C@@H]2OC[C@@H]([C@@H]([C@H]2O)O[C@@H]2OC[C@H]([C@@H]([C@H]2OC(=O)C)OC(=O)C)OC(=O)C)O)O)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
Soyasaponin Aa, a natural compound found in soybeans, possesses unique properties that make it a valuable tool in chemical synthesis. This plant-based substance has been increasingly used in organic chemistry as a versatile reagent for various synthetic transformations. Soyasaponin Aa's ability to selectively functionalize certain functional groups in molecules, its environmentally friendly nature, and its relatively low cost compared to conventional reagents make it an attractive option for chemists seeking more sustainable and efficient synthetic methods. The application of Soyasaponin Aa in chemical synthesis extends to diverse areas such as pharmaceuticals, materials science, and the development of new compounds with potential industrial applications. Its prominent role in promoting greener and more efficient synthetic routes highlights the growing significance of natural products in modern synthetic chemistry.