AA18085
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $89.00 | $62.00 | - + | |
5g | 98% | in stock | $265.00 | $186.00 | - + | |
25g | 98% | in stock | $1,007.00 | $705.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA18085 |
Chemical Name: | tert-Butyl 3-(aminomethyl)azetidine-1-carboxylate hydrochloride |
CAS Number: | 1173206-71-7 |
Molecular Formula: | C9H19ClN2O2 |
Molecular Weight: | 222.7124 |
MDL Number: | MFCD11101335 |
SMILES: | NCC1CN(C1)C(=O)OC(C)(C)C.Cl |
Complexity: | 192 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
The tert-Butyl 3-(aminomethyl)azetidine-1-carboxylate hydrochloride plays a crucial role in chemical synthesis as a versatile building block with unique properties. Its application in organic synthesis is particularly notable for its ability to introduce the azetidine backbone into organic molecules, thereby enhancing their structural diversity and potential biological activity. This compound can serve as a valuable precursor for the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals through its incorporation into key intermediates. Its functional groups and stereochemistry make it a valuable tool for designing and producing novel compounds with targeted properties.