AA18268
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $26.00 | $18.00 | - + | |
1g | 98% | in stock | $31.00 | $22.00 | - + | |
25g | 98% | in stock | $770.00 | $539.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA18268 |
Chemical Name: | Ethyl 4-ethoxy-2-oxo-1,2-dihydropyridine-3-carboxylate |
CAS Number: | 1174046-84-4 |
Molecular Formula: | C10H13NO4 |
Molecular Weight: | 211.2145 |
MDL Number: | MFCD28341417 |
SMILES: | CCOC(=O)c1c(OCC)cc[nH]c1=O |
Complexity: | 330 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 0.7 |
Ethyl 4-ethoxy-2-oxo-1,2-dihydropyridine-3-carboxylate is a versatile compound commonly used in chemical synthesis. Its unique structure makes it an important building block in the creation of various organic compounds. Due to its reactivity and functional groups, this compound is often employed in the synthesis of heterocyclic compounds and pharmaceutical intermediates. Additionally, Ethyl 4-ethoxy-2-oxo-1,2-dihydropyridine-3-carboxylate can serve as a key starting material for the preparation of diverse molecules with potential applications in drug discovery and materials science. Its role in organic synthesis highlights its significance as a valuable asset in the field of chemistry.