AE25065
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $47.00 | $33.00 | - + | |
1g | 95% | in stock | $98.00 | $69.00 | - + | |
5g | 95% | in stock | $333.00 | $233.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE25065 |
Chemical Name: | (E)-Methyl 2-(2-(bromomethyl)phenyl)-3-methoxyacrylate |
CAS Number: | 117428-49-6 |
Molecular Formula: | C12H13BrO3 |
Molecular Weight: | 285.1338 |
MDL Number: | MFCD16038453 |
SMILES: | CO/C=C(c1ccccc1CBr)/C(=O)OC |
(E)-Methyl 2-(2-(bromomethyl)phenyl)-3-methoxyacrylate is a key compound widely used in chemical synthesis for its versatile applications. This compound serves as a valuable building block for the synthesis of various organic molecules and pharmaceutical intermediates. Its unique structure combines the reactivity of an acrylate group with the presence of a bromomethylphenyl moiety, allowing for diverse reactions and functional group transformations.In chemical synthesis, (E)-Methyl 2-(2-(bromomethyl)phenyl)-3-methoxyacrylate can be utilized in the construction of complex molecular frameworks through reactions such as nucleophilic substitutions, cross-coupling reactions, and cyclization reactions. The bromomethyl group provides a site for further derivatization or attachment of other functional groups, enabling the creation of elaborate molecular architectures. Additionally, the acrylate moiety offers the potential for polymerization reactions and the formation of conjugated systems with interesting optoelectronic properties.Overall, the strategic incorporation of (E)-Methyl 2-(2-(bromomethyl)phenyl)-3-methoxyacrylate in chemical synthesis enables chemists to access a wide array of chemical transformations, making it an indispensable tool for the construction of diverse organic molecules with tailored properties and functionalities.