117428-51-0 | Benzeneacetic acid, 2-(chloromethyl)-α-(methoxymethylene)-, methyl ester, (αE)-

Availability
Typically In Stock

Description

• Catalog Number: AA18351
• Chemical Name: Benzeneacetic acid, 2-(chloromethyl)-α-(methoxymethylene)-, methyl ester, (αE)-
• CAS Number: 117428-51-0
• MDL Number: MFCD14635207
• SMILES: CO/C=C(c1ccccc1CCl)/C(=O)OC

Upstream Synthesis Route

(E)-Methyl 2-(2-(chloromethyl)phenyl)-3-methoxyacrylate is a versatile compound commonly used in chemical synthesis as a key building block for the creation of new molecules. This compound plays a crucial role in the synthesis of various pharmaceuticals, agrochemicals, and organic materials due to its unique chemical properties.In chemical synthesis, (E)-Methyl 2-(2-(chloromethyl)phenyl)-3-methoxyacrylate serves as a valuable starting material for the production of complex organic compounds. Its reactive acrylate group enables it to participate in a wide range of chemical reactions, such as nucleophilic substitution, addition reactions, and cross-coupling reactions. This compound can undergo functional group transformations to introduce different chemical functionalities, making it highly adaptable for the synthesis of diverse molecular structures.Furthermore, the presence of the aromatic phenyl group and the methoxy substituent in (E)-Methyl 2-(2-(chloromethyl)phenyl)-3-methoxyacrylate offers opportunities for further derivatization and modification, allowing chemists to tailor the compound for specific applications. Its chloromethyl group also provides a site for selective functionalization, enabling the introduction of additional chemical moieties to enhance the desired properties of the synthesized molecules.Overall, (E)-Methyl 2-(2-(chloromethyl)phenyl)-3-methoxyacrylate is a valuable tool in chemical synthesis, offering flexibility, reactivity, and functionality for the creation of novel organic compounds with potential applications across various industries.