117436-78-9 | Chitotriose Trihydrochloride Hydrate

Packsize	Purity	Availability	Price	Discounted Price
25mg	85%	in stock	$398.00	$279.00

Description

• Catalog Number: AE15961
• Chemical Name: Chitotriose Trihydrochloride Hydrate
• CAS Number: 117436-78-9
• Molecular Formula: C18H36ClN3O13
• Molecular Weight: 537.9437
• MDL Number: MFCD00210268
• SMILES: OC[C@H]([C@H]([C@@H]([C@H](C=O)N)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1N)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1N)O)O)O.Cl

Upstream Synthesis Route

Chitotriose Trihydrochloride Hydrate is a versatile compound commonly used in chemical synthesis for its unique properties and applications. This compound plays a crucial role in organic chemistry as a key building block in the creation of various chitin derivatives. Its hydrochloride form enhances its solubility in aqueous solutions, making it ideal for use in reactions that require water as a medium.In chemical synthesis, Chitotriose Trihydrochloride Hydrate serves as a valuable starting material for the development of novel biodegradable materials, bioactive compounds, and pharmaceuticals. Its three glucose units linked by β-1,4-glycosidic bonds provide a scaffold for structural modifications, leading to the synthesis of diverse chitin-based polymers with tailored functionalities.Furthermore, Chitotriose Trihydrochloride Hydrate can act as a chiral auxiliary in asymmetric synthesis, facilitating the creation of enantiomerically pure compounds. This compound's ability to form inclusion complexes with other molecules also makes it a valuable tool in host-guest chemistry and supramolecular chemistry studies.Overall, Chitotriose Trihydrochloride Hydrate's importance in chemical synthesis lies in its ability to enable the construction of complex molecules with precision and efficiency, making it a valuable asset in the development of new materials and compounds with a wide range of applications.