BJ80624
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $260.00 | $182.00 | - + | |
250mg | 98% | in stock | $422.00 | $296.00 | - + | |
1g | 98% | in stock | $843.00 | $591.00 | - + | |
5g | 98% | in stock | $2,949.00 | $2,064.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BJ80624 |
Chemical Name: | Ethyl (R)-2-(tosyloxy)propanoate |
CAS Number: | 117589-34-1 |
Molecular Formula: | C12H16O5S |
Molecular Weight: | 272.3174 |
SMILES: | CCOC(=O)[C@H](OS(=O)(=O)c1ccc(cc1)C)C |
Ethyl (R)-2-(tosyloxy)propanoate, a versatile compound in chemical synthesis, serves as a valuable building block for the creation of various organic molecules. This compound is commonly employed as an intermediate in the preparation of different esters, ethers, and other functionalized organic compounds. Its unique structure and reactivity make it a key component in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals.In chemical synthesis, Ethyl (R)-2-(tosyloxy)propanoate undergoes various reactions such as nucleophilic substitution, esterification, and elimination reactions to yield a wide range of products. Its tosylate group can act as a leaving group, facilitating substitution reactions, while its ethyl ester moiety can be easily transformed into other functional groups, enabling the synthesis of complex organic molecules. Additionally, the chiral center in this compound allows for the production of enantiomerically pure substances, an essential requirement in pharmaceutical synthesis.Overall, Ethyl (R)-2-(tosyloxy)propanoate plays a crucial role in the diversification of chemical compounds through its participation in multiple synthetic pathways, making it a valuable resource in the realm of organic chemistry.