AE14430
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 99% | in stock | $78.00 | $54.00 | - + | |
250mg | 99% | in stock | $146.00 | $102.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE14430 |
Chemical Name: | Sch 37370 |
CAS Number: | 117796-52-8 |
Molecular Formula: | C21H21ClN2O |
Molecular Weight: | 352.8572 |
MDL Number: | MFCD00873685 |
SMILES: | Clc1ccc2c(c1)CCc1c(C2=C2CCN(CC2)C(=O)C)nccc1 |
N-acetyldesloratadine, also known as desloratadine, is a key intermediate in chemical synthesis that is widely utilized in the pharmaceutical industry. This compound plays a crucial role in the production of antihistamine medications, specifically those designed to treat allergic conditions such as hay fever, hives, and allergic rhinitis. By incorporating N-acetyldesloratadine into the synthesis process, pharmaceutical companies are able to create effective and potent drugs that target histamine receptors in the body, providing relief from allergy symptoms. The versatility of N-acetyldesloratadine in chemical synthesis makes it a valuable component in the development of new and improved pharmaceutical formulations.