logo
Home  > 4-(2,4-Dimethoxyphenyl)-5-methylthiazol-2-amine

AD61018

117844-98-1 | 4-(2,4-Dimethoxyphenyl)-5-methylthiazol-2-amine

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $106.00 $75.00 -   +
1g 95% in stock $125.00 $87.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD61018
Chemical Name: 4-(2,4-Dimethoxyphenyl)-5-methylthiazol-2-amine
CAS Number: 117844-98-1
Molecular Formula: C12H14N2O2S
Molecular Weight: 250.3168
MDL Number: MFCD03145141
SMILES: COc1cc(OC)ccc1c1nc(sc1C)N

 

Upstream Synthesis Route 
  • 4-(2,4-Dimethoxyphenyl)-5-methylthiazol-2-amine, also known by its chemical structure as C12H14N2O2S, is a versatile compound widely utilized in chemical synthesis. This particular compound plays a crucial role as a building block in the creation of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure allows for selective modification at different positions, enabling chemists to design and produce novel molecules with specific properties and functions. In chemical synthesis, 4-(2,4-Dimethoxyphenyl)-5-methylthiazol-2-amine serves as a valuable intermediate in the development of new drug candidates, agrochemical agents, and complex organic compounds. Its presence in the synthesis process contributes to the diversification of chemical libraries and the advancement of medicinal chemistry research.
FEATURED PRODUCTS