logo
Home  > Boc-menle-oh

AB50384

117903-25-0 | Boc-menle-oh

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $110.00 $77.00 -   +
5g 95% in stock $362.00 $253.00 -   +
10g 95% in stock $609.00 $427.00 -   +
25g 95% in stock $1,196.00 $837.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB50384
Chemical Name: Boc-menle-oh
CAS Number: 117903-25-0
Molecular Formula: C12H23NO4
Molecular Weight: 245.3153
MDL Number: MFCD00153391
SMILES: CCCC[C@H](N(C(=O)OC(C)(C)C)C)C(=O)O

 

Upstream Synthesis Route 
  • N-tert-Butoxycarbonyl-N-methyl-L-norleucine is a valuable compound used in chemical synthesis due to its ability to act as a protecting group for amino acids. This compound plays a crucial role in peptide synthesis, where it masks the amino group in a temporary and reversible manner, allowing specific reactions to occur without undesired interactions. By selectively protecting the amino group with N-tert-Butoxycarbonyl-N-methyl-L-norleucine, chemists can control the reactivity and stereochemistry of amino acids during peptide assembly. This compound is particularly useful in the synthesis of complex peptides and proteins, where precise control over the sequence and structure is essential for biological activity or pharmaceutical applications.
FEATURED PRODUCTS