AE19693
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | 1 week | $34.00 | $24.00 | - + | |
250mg | 95% | 1 week | $59.00 | $42.00 | - + | |
1g | 95% | 1 week | $142.00 | $100.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE19693 |
Chemical Name: | 5-Phenylpicolinimidamide hydrochloride |
CAS Number: | 1179362-50-5 |
Molecular Formula: | C12H12ClN3 |
Molecular Weight: | 233.6968 |
MDL Number: | MFCD12755603 |
SMILES: | NC(=N)c1ccc(cn1)c1ccccc1.Cl |
Complexity: | 221 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
5-Phenylpicolinimidamide hydrochloride is a versatile compound widely used in chemical synthesis due to its ability to serve as a key building block in the creation of various organic molecules. This compound plays a crucial role in the formation of complex structures through its participation in diverse synthetic reactions such as amidation, esterification, and Suzuki coupling. Its unique chemical properties enable it to facilitate the efficient construction of pharmaceutical intermediates, agrochemicals, and functional materials. By functioning as a crucial intermediate in the synthesis of intricate organic compounds, 5-Phenylpicolinimidamide hydrochloride contributes significantly to the advancement of modern chemistry and the development of novel substances with a broad range of applications.