AD60964
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $129.00 | $90.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD60964 |
Chemical Name: | 1,2-Difluoro-4-[trans-4-[2-(trans-4-propylcyclohexyl)ethyl]cyclohexyl]benzene |
CAS Number: | 117943-37-0 |
Molecular Formula: | C23H34F2 |
Molecular Weight: | 348.5129 |
MDL Number: | MFCD12912373 |
SMILES: | CCC[C@@H]1CC[C@H](CC1)CC[C@@H]1CC[C@H](CC1)c1ccc(c(c1)F)F |
1,2-Difluoro-4-[trans-4-[2-(trans-4-propylcyclohexyl)ethyl]cyclohexyl]benzene is a highly versatile compound that finds wide application in chemical synthesis processes. This compound serves as a valuable building block in the development of novel organic molecules with distinct properties and functionalities. Its unique structure enables it to act as a key intermediate in the synthesis of complex organic compounds and materials.In chemical synthesis, 1,2-Difluoro-4-[trans-4-[2-(trans-4-propylcyclohexyl)ethyl]cyclohexyl]benzene can be utilized as a critical component in the creation of advanced materials such as liquid crystals, polymers, pharmaceuticals, and agrochemicals. Its fluorinated structure imparts specific characteristics to the resulting products, making them useful in a variety of industrial applications.Furthermore, the strategic positioning of functional groups in this compound allows for precise modifications and derivatizations, enabling chemists to tailor the synthesis of target molecules with enhanced properties. By incorporating 1,2-Difluoro-4-[trans-4-[2-(trans-4-propylcyclohexyl)ethyl]cyclohexyl]benzene into synthetic pathways, researchers can achieve efficient and controlled chemical transformations to access a diverse array of molecular structures with desired attributes.