logo
Home  > Inhibitors/Agonists  > Natural Products  > Nature Product  > Syringin

AB51377

118-34-3 | Syringin

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $33.00 $23.00 -   +
10mg 95% in stock $50.00 $35.00 -   +
100mg 95% in stock $65.00 $46.00 -   +
250mg 95% in stock $121.00 $85.00 -   +
1g 95% in stock $325.00 $228.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB51377
Chemical Name: Syringin
CAS Number: 118-34-3
Molecular Formula: C17H24O9
Molecular Weight: 372.3671
MDL Number: MFCD00016778
SMILES: OC/C=C/c1cc(OC)c(c(c1)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

 

Computed Properties
Complexity: 432  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 5  
Defined Bond Stereocenter Count: 1  
Heavy Atom Count: 26  
Hydrogen Bond Acceptor Count: 9  
Hydrogen Bond Donor Count: 5  
Rotatable Bond Count: 7  
XLogP3: -1.3  

 

 

Upstream Synthesis Route
  • Syringin, a natural phenolic compound found in various plant species, plays a significant role in chemical synthesis as a versatile building block for the creation of various compounds. In the field of organic chemistry, syringin is utilized as a starting material or intermediate in the synthesis of fragrances, pharmaceuticals, and other fine chemicals. Its structure contains functional groups that enable diverse chemical transformations, making it a valuable precursor in the production of complex molecules. Researchers often leverage syringin's reactivity and compatibility with various reaction conditions to tailor its structure for specific applications, allowing for the development of novel compounds with potential industrial or medicinal uses. Additionally, the unique properties of syringin make it a valuable tool for exploring new synthetic methods and enhancing our understanding of chemical reactivity in organic synthesis.
Literature
FEATURED PRODUCTS