logo
Home  > Imidazo[1,2-a]pyridine-3-acetamide,a-hydroxy-N,N,6-trimethyl-2-(4-methylphenyl)-

AD35605

118026-14-5 | Imidazo[1,2-a]pyridine-3-acetamide,a-hydroxy-N,N,6-trimethyl-2-(4-methylphenyl)-

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD35605
Chemical Name: Imidazo[1,2-a]pyridine-3-acetamide,a-hydroxy-N,N,6-trimethyl-2-(4-methylphenyl)-
CAS Number: 118026-14-5
Molecular Formula: C19H23N3O2
Molecular Weight: 325.4048
MDL Number: MFCD08704812
SMILES: CC1=CN2C(=NC(C2CC(=O)N(C)C)(O)c2ccc(cc2)C)C=C1

 

Upstream Synthesis Route 
  • The compound α-Hydroxy-N,N,6-trimethyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetamide plays a crucial role in chemical synthesis as a versatile intermediate. Due to its unique structure and functional groups, this compound serves as a valuable building block in the creation of various organic molecules and pharmaceuticals. Its presence allows for the introduction of specific functionalities and sterics into target molecules, leading to the synthesis of diverse chemical compounds with tailored properties and activities. This compound's reactivity and stability make it an essential tool for chemists seeking to design and develop novel molecules for applications in drug discovery, materials science, and beyond.
FEATURED PRODUCTS