logo
Home  > Phosphonic acid, [1-hydroxy-2-(1H-imidazol-1-yl)ethylidene]bis-

AI11570

118072-93-8 | Phosphonic acid, [1-hydroxy-2-(1H-imidazol-1-yl)ethylidene]bis-

Packsize Purity Availability Price Discounted Price    Quantity
1mg 97% in stock $11.00 $8.00 -   +
10mg 97% in stock $13.00 $9.00 -   +
50mg 97% in stock $16.00 $11.00 -   +
100mg 97% in stock $19.00 $13.00 -   +
250mg 97% in stock $29.00 $20.00 -   +
1g 97% in stock $66.00 $47.00 -   +
5g 97% in stock $157.00 $110.00 -   +
10g 97% in stock $269.00 $189.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI11570
Chemical Name: Phosphonic acid, [1-hydroxy-2-(1H-imidazol-1-yl)ethylidene]bis-
CAS Number: 118072-93-8
Molecular Formula: C5H10N2O7P2
Molecular Weight: 272.08962199999996
MDL Number: MFCD18426508
SMILES: OP(=O)(C(P(=O)(O)O)(Cn1cncc1)O)O
NSC Number: 721517

 

Computed Properties
Complexity: 327  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 16  
Hydrogen Bond Acceptor Count: 8  
Hydrogen Bond Donor Count: 5  
Rotatable Bond Count: 4  
XLogP3: -4.3  

 

 

Upstream Synthesis Route 
  • (1-Hydroxy-2-imidazol-1-ylethylidene)diphosphonic acid, also known as $name$, is a versatile compound widely utilized in chemical synthesis due to its unique properties and reactivity. As a chelating agent, it plays a crucial role in coordinating metal ions, particularly transition metals, in various chemical reactions. In organic synthesis, $name$ is commonly employed as a complexing agent to control the coordination environments of metal ions, facilitating the formation of specific molecular structures. Its ability to form stable complexes with metal ions makes it an essential component in catalytic processes, such as metal-catalyzed reactions and metal-mediated transformations.Furthermore, (1-Hydroxy-2-imidazol-1-ylethylidene)diphosphonic acid serves as an effective scale inhibitor in industrial applications, where it helps prevent the formation of scale deposits by sequestering metal ions and inhibiting their precipitation. This property makes it valuable in various industries, including water treatment, oil and gas production, and chemical manufacturing processes.Overall, the application of $name$ in chemical synthesis encompasses its role as a chelating agent, complexing agent, and scale inhibitor, highlighting its versatility and importance in a wide range of chemical reactions and industrial processes.
Literature
FEATURED PRODUCTS