logo
Home  > 4-[Trans-4-(trans-4-ethylcyclohexyl)cyclohexyl]-1,2-difluorobenzene

AB79753

118164-50-4 | 4-[Trans-4-(trans-4-ethylcyclohexyl)cyclohexyl]-1,2-difluorobenzene

Packsize Purity Availability Price Discounted Price    Quantity
5g 97% in stock $9.00 $6.00 -   +
25g 97% in stock $28.00 $19.00 -   +
100g 97% in stock $79.00 $55.00 -   +
500g 97% in stock $345.00 $241.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB79753
Chemical Name: 4-[Trans-4-(trans-4-ethylcyclohexyl)cyclohexyl]-1,2-difluorobenzene
CAS Number: 118164-50-4
Molecular Formula: C20H28F2
Molecular Weight: 306.4331
MDL Number: MFCD13188635
SMILES: CC[C@@H]1CC[C@H](CC1)[C@@H]1CC[C@H](CC1)c1ccc(c(c1)F)F

 

Upstream Synthesis Route 
  • The trans,trans-4-(3,4-Difluorophenyl)-4'-ethyl-1,1'-bi(cyclohexane) compound is a versatile building block widely used in chemical synthesis. Its unique structure makes it valuable for various synthetic applications due to its distinct stereochemistry and substituents.In chemical synthesis, trans,trans-4-(3,4-Difluorophenyl)-4'-ethyl-1,1'-bi(cyclohexane) serves as a key intermediate for creating complex organic molecules. Its trans configuration allows for specific molecular orientations during reactions, leading to the formation of desired products with defined stereochemistry.The presence of the difluorophenyl and ethyl groups in the compound enhances its reactivity and functionality in organic transformations. These groups can participate in various chemical reactions such as cross-coupling reactions, nucleophilic substitutions, and metal-catalyzed processes, expanding the synthetic utility of trans,trans-4-(3,4-Difluorophenyl)-4'-ethyl-1,1'-bi(cyclohexane).Overall, this compound plays a crucial role in the synthesis of diverse organic compounds, pharmaceuticals, and materials, highlighting its significance in modern chemical research and development.
FEATURED PRODUCTS