AD74641
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $180.00 | $126.00 | - + | |
5mg | 95% | in stock | $446.00 | $312.00 | - + | |
10mg | 95% | in stock | $669.00 | $468.00 | - + | |
25mg | 95% | in stock | $1,138.00 | $796.00 | - + | |
50mg | 95% | in stock | $1,934.00 | $1,354.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD74641 |
Chemical Name: | Cynarin |
CAS Number: | 1182-34-9 |
Molecular Formula: | C17H20O9 |
Molecular Weight: | 368.3353 |
MDL Number: | MFCD13196510 |
SMILES: | CO[C@]1(CC[C@H]([C@H]([C@@H]1O)O)OC(=O)/C=C/c1ccc(c(c1)O)O)C(=O)O |
Cynarin, a natural compound found in artichokes, is widely utilized in chemical synthesis for its diverse applications and characteristics. In particular, its ability to act as an antioxidant makes it a valuable component in the development of skincare products and pharmaceuticals. Additionally, Cynarin's role as a chelating agent enhances its use in environmental remediation processes, where it assists in the removal of heavy metals from contaminated sites. Moreover, Cynarin's chemical structure enables it to participate in organic reactions, leading to the creation of novel compounds with potential industrial and medicinal benefits. Through its multifaceted properties, Cynarin contributes significantly to the advancement of various fields within chemical synthesis.