AE14126
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 4 weeks | $331.00 | $232.00 | - + | ||
5mg | 3 weeks | $448.00 | $314.00 | - + | ||
10mg | 3 weeks | $676.00 | $473.00 | - + | ||
25mg | 3 weeks | $1,206.00 | $844.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE14126 |
Chemical Name: | N-DEMETHYLROXITHROMYCIN |
CAS Number: | 118267-18-8 |
Molecular Formula: | C40H74N2O15 |
Molecular Weight: | 823.02 |
MDL Number: | MFCD28898470 |
SMILES: | COCCOCO/N=C/1[C@H](C)C[C@@](C)(O)[C@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)NC)[C@@H](C)[C@H](O[C@@H]2O[C@@H](C)[C@@H]([C@](C2)(C)OC)O)[C@H](C(=O)O[C@@H]([C@@]([C@@H]([C@H]1C)O)(C)O)CC)C |
The N-Demethyl Roxithromycin compound plays a crucial role in chemical synthesis as a versatile building block. Its unique chemical properties allow it to be involved in the creation of various pharmaceuticals, agrochemicals, and materials. Specifically, it can be used as a key intermediate in the synthesis of novel antibiotics or antimicrobial agents. Additionally, its presence in the synthesis process can enhance the efficacy and specificity of the final products. Given its significance in chemical synthesis, N-Demethyl Roxithromycin serves as a valuable tool for researchers and scientists aiming to develop innovative compounds with potential therapeutic or industrial applications.